4-methoxy-N-[4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]benzenesulfonamide structure
|
Common Name | 4-methoxy-N-[4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6938-21-2 | Molecular Weight | 260.67100 | |
| Density | 1.285g/cm3 | Boiling Point | 404.8ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | 2-chloro-1-(2-hydroxy-3,4,6-trimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760 mmHg |
| Molecular Formula | C11H13ClO5 |
| Molecular Weight | 260.67100 |
| Flash Point | 198.6ºC |
| Exact Mass | 260.04500 |
| PSA | 64.99000 |
| LogP | 1.83950 |
| Index of Refraction | 1.534 |
| InChIKey | SGCKTGAQKXRWBL-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)CCl)c(O)c1OC |
|
~%
4-methoxy-N-[4-... CAS#:6938-21-2 |
| Literature: Horton; Paul Journal of Organic Chemistry, 1959 , vol. 24, p. 2000,2002 |
|
~%
4-methoxy-N-[4-... CAS#:6938-21-2 |
| Literature: Horton; Paul Journal of Organic Chemistry, 1959 , vol. 24, p. 2000,2002 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Chlor-1-(2-hydroxy-3,4,6-trimethoxy-phenyl)-aethanon |
| 2-chloro-1-(2-hydroxy-3,4,6-trimethoxy-phenyl)-ethanone |