N-(2-bromo-4-methylsulfonylimino-naphthalen-1-ylidene)methanesulfonamide structure
|
Common Name | N-(2-bromo-4-methylsulfonylimino-naphthalen-1-ylidene)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6938-23-4 | Molecular Weight | 274.69800 | |
| Density | 1.202g/cm3 | Boiling Point | 396.2ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.5ºC | |
| Name | 2-Chlor-1-(1-phenyl-1H-[1,2,3]triazol-4-yl)-aethanon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 396.2ºC at 760 mmHg |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.69800 |
| Flash Point | 160.5ºC |
| Exact Mass | 274.06100 |
| PSA | 53.99000 |
| LogP | 2.14250 |
| Index of Refraction | 1.505 |
| InChIKey | BUCRGFFAIFGTRZ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)CCl)c(OC)c1OC |
|
~%
N-(2-bromo-4-me... CAS#:6938-23-4 |
| Literature: Horton; Paul Journal of Organic Chemistry, 1959 , vol. 24, p. 2000,2002 |
| 2-chloro-1-(2,3,4,6-tetramethoxy-phenyl)-ethanone |
| 2-chloro-1-(1-phenyl-1H-[1,2,3]triazol-4-yl)-ethanone |
| 2-Chlor-1-(2,3,4,6-tetramethoxy-phenyl)-aethanon |
| Ethanone,2-chloro-1-(1-phenyl-1H-1,2,3-triazol-4-yl) |