2-Butenoic acid, pentyl ester, (2E)- structure
|
Common Name | 2-Butenoic acid, pentyl ester, (2E)- | ||
|---|---|---|---|---|
| CAS Number | 6938-30-3 | Molecular Weight | 345.26400 | |
| Density | 1.48g/cm3 | Boiling Point | 500ºC at 760 mmHg | |
| Molecular Formula | C15H11N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.2ºC | |
| Name | [(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 500ºC at 760 mmHg |
| Molecular Formula | C15H11N3O7 |
| Molecular Weight | 345.26400 |
| Flash Point | 256.2ºC |
| Exact Mass | 345.06000 |
| PSA | 147.37000 |
| LogP | 3.53750 |
| Index of Refraction | 1.641 |
| InChIKey | DFVPKLOAEGYEOQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(=NOC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C=CC1=O |
|
~95%
2-Butenoic acid... CAS#:6938-30-3 |
| Literature: Yadav; Reddy, Gondi Sudershan; Srinivas, Dale; Himabindu, Konuru Synthetic Communications, 1998 , vol. 28, # 13 p. 2337 - 2342 |
|
~%
2-Butenoic acid... CAS#:6938-30-3 |
| Literature: Jeffery; Vogel Journal of the Chemical Society, 1948 , p. 663 |
|
~%
2-Butenoic acid... CAS#:6938-30-3 |
| Literature: Braendstroem Arkiv foer Kemi, 1949 , vol. 1, p. 481 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| trans-Crotonsaeure-pentylester |
| pentyl 2-butenoate |
| trans-crotonic acid pentyl ester |