2,7-diterbutyl carbazole
2,7-diterbutyl carbazole structure
|
Common Name | 2,7-diterbutyl carbazole | ||
|---|---|---|---|---|
| CAS Number | 69386-35-2 | Molecular Weight | 279.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25N | Melting Point | 154 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-di-tert-butylcarbazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 154 °C |
|---|---|
| Molecular Formula | C20H25N |
| Molecular Weight | 279.41900 |
| Exact Mass | 279.19900 |
| PSA | 15.79000 |
| LogP | 5.91610 |
| InChIKey | YAWXNJICXSLGGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)[nH]c1cc(C(C)(C)C)ccc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:98-51-1
CAS#:86-74-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,7-di-tert-butyl-carbazole |
| 2,7-Di-tert.-butyl-carbazol |
| 2,7-di-tertbutylcarbazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,7-di-tert-butylcarbazole? |
| A: CAS number of 2,7-di-tert-butylcarbazole is 69386-35-2. |
| Q: What English synonyms does 2,7-di-tert-butylcarbazole have? |
| A: English synonyms of 2,7-di-tert-butylcarbazole: 2,7-di-tert-butyl-carbazole, 2,7-Di-tert.-butyl-carbazol, 2,7-di-tertbutylcarbazole. |
| Q: What is the molecular formula of 2,7-di-tert-butylcarbazole? |
| A: Molecular formula of 2,7-di-tert-butylcarbazole is C20H25N. |
| Q: What is the melting point of 2,7-di-tert-butylcarbazole? |
| A: Melting point of 2,7-di-tert-butylcarbazole is 154 °C. |
| Q: What is the InChIKey of 2,7-di-tert-butylcarbazole? |
| A: InChIKey of 2,7-di-tert-butylcarbazole is YAWXNJICXSLGGQ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2,7-di-tert-butylcarbazole? |
| A: Polar surface area (PSA) of 2,7-di-tert-butylcarbazole is 15.79000. |
| Q: What is the English name of 2,7-di-tert-butylcarbazole? |
| A: The English name of 2,7-di-tert-butylcarbazole is 2,7-di-tert-butylcarbazole. |
| Q: What is the SMILES notation of 2,7-di-tert-butylcarbazole? |
| A: SMILES notation of 2,7-di-tert-butylcarbazole is CC(C)(C)c1ccc2c(c1)[nH]c1cc(C(C)(C)C)ccc12. |
| Q: What is the LogP of 2,7-di-tert-butylcarbazole? |
| A: LogP of 2,7-di-tert-butylcarbazole is 5.91610. |
| Q: What are the downstream products of 2,7-di-tert-butylcarbazole? |
| A: Related downstream products(CAS) of 2,7-di-tert-butylcarbazole: 98-51-1;86-74-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |