diethyl 2-[(3,4-dimethylphenyl)amino]propanedioate structure
|
Common Name | diethyl 2-[(3,4-dimethylphenyl)amino]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 6939-60-2 | Molecular Weight | 279.33200 | |
| Density | 1.127g/cm3 | Boiling Point | 372.6ºC at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.1ºC | |
| Name | diethyl 2-(3,4-dimethylanilino)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 372.6ºC at 760 mmHg |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.33200 |
| Flash Point | 179.1ºC |
| Exact Mass | 279.14700 |
| PSA | 64.63000 |
| LogP | 2.28310 |
| Index of Refraction | 1.532 |
| InChIKey | GTKWBWOLLYGURN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Nc1ccc(C)c(C)c1)C(=O)OCC |
|
~%
diethyl 2-[(3,4... CAS#:6939-60-2 |
| Literature: O'Brien,D.E. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 1085 - 1103 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethyl[(3,4-dimethylphenyl)amino]propanedioate |
| 2-<3,4-Dimethyl-anilino>-malonsaeure-diaethylester |