N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide
Modify Date: 2026-07-31 22:31:54
N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide structure
|
Common Name | N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 69413-35-0 | Molecular Weight | 235.67000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10ClN3O |
|---|---|
| Molecular Weight | 235.67000 |
| Exact Mass | 235.05100 |
| PSA | 50.41000 |
| LogP | 2.93870 |
| InChIKey | FKUIJFDEJBHGML-UHFFFAOYSA-N |
| SMILES | Cc1ccn(C(=O)Nc2cccc(Cl)c2)n1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:1453-58-3
CAS#:3023-72-1
CAS#:2909-38-8
CAS#:15442-04-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 69413-35-0? |
| A: Chinese name of 69413-35-0 is 69413-35-0. |
| Q: What are the downstream products of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: Related downstream products(CAS) of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide: 1453-58-3;3023-72-1;2909-38-8;15442-04-3. |
| Q: What is the LogP of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: LogP of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is 2.93870. |
| Q: What is the CAS number of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: CAS number of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is 69413-35-0. |
| Q: What is the polar surface area (PSA) of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: Polar surface area (PSA) of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is 50.41000. |
| Q: What is the molecular weight of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: Molecular weight of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is 235.67000. |
| Q: What is the English name of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: The English name of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide. |
| Q: What is the molecular formula of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: Molecular formula of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is C11H10ClN3O. |
| Q: What is the SMILES notation of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: SMILES notation of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is Cc1ccn(C(=O)Nc2cccc(Cl)c2)n1. |
| Q: What is the InChIKey of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide? |
| A: InChIKey of N-(3-chlorophenyl)-3-methylpyrazole-1-carboxamide is FKUIJFDEJBHGML-UHFFFAOYSA-N. |