4-methylumbelliferyl alpha-l-arabinopyranoside structure
|
Common Name | 4-methylumbelliferyl alpha-l-arabinopyranoside | ||
|---|---|---|---|---|
| CAS Number | 69414-26-2 | Molecular Weight | 308.283 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 572.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 217.3±23.6 °C | |
| Name | 4-METHYLUMBELLIFERYL α-L-ARABINOPYRANOSIDE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 572.1±50.0 °C at 760 mmHg |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.283 |
| Flash Point | 217.3±23.6 °C |
| Exact Mass | 308.089600 |
| PSA | 109.36000 |
| LogP | 1.02 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | JWIYLOHVJDJZOQ-HPEDKQMDSA-N |
| SMILES | Cc1cc(=O)oc2cc(OC3OCC(O)C(O)C3O)ccc12 |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00064087 |
| 4-Methyl-2-oxo-2H-chromen-7-yl α-L-arabinopyranoside |
| 4-methylumbelliferyl A-L-*arabinopyranoside |
| 4-methylumbelliferyl α-L-arabinoside |
| 2H-1-Benzopyran-2-one, 7-(α-L-arabinopyranosyloxy)-4-methyl- |
| Einecs 273-991-2 |
| 4-Methylumbelliferyl-A-L-Arabino |