Benzoicacid, 3-methyl-, 2-[1,1'-biphenyl]-4-yl-2-oxoethyl ester structure
|
Common Name | Benzoicacid, 3-methyl-, 2-[1,1'-biphenyl]-4-yl-2-oxoethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6942-69-4 | Molecular Weight | 330.37700 | |
| Density | 1.16g/cm3 | Boiling Point | 529.1ºC at 760mmHg | |
| Molecular Formula | C22H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.9ºC | |
| Name | [2-oxo-2-(4-phenylphenyl)ethyl] 3-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 529.1ºC at 760mmHg |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.37700 |
| Flash Point | 232.9ºC |
| Exact Mass | 330.12600 |
| PSA | 43.37000 |
| LogP | 4.70170 |
| Index of Refraction | 1.597 |
| InChIKey | BBZQNFMYIRYYHY-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)OCC(=O)c2ccc(-c3ccccc3)cc2)c1 |
|
~%
Benzoicacid, 3-... CAS#:6942-69-4 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
Benzoicacid, 3-... CAS#:6942-69-4 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
Benzoicacid, 3-... CAS#:6942-69-4 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-methyl-benzoic acid-(4-phenyl-phenacyl ester) |
| 3-Methyl-benzoesaeure-(4-phenyl-phenacylester) |
| 2-(biphenyl-4-yl)-2-oxoethyl 3-methylbenzoate |