Benzene,1,1'-[1,6-hexanediylbis(oxy)]bis[4-bromo- (9CI) structure
|
Common Name | Benzene,1,1'-[1,6-hexanediylbis(oxy)]bis[4-bromo- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6943-11-9 | Molecular Weight | 428.15800 | |
| Density | 1.442g/cm3 | Boiling Point | 490.2ºC at 760 mmHg | |
| Molecular Formula | C18H20Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-4-[6-(4-bromophenoxy)hexoxy]benzene |
|---|
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 490.2ºC at 760 mmHg |
| Molecular Formula | C18H20Br2O2 |
| Molecular Weight | 428.15800 |
| Exact Mass | 425.98300 |
| PSA | 18.46000 |
| LogP | 6.22980 |
| Index of Refraction | 1.572 |
| InChIKey | RCTHJRFRURADHF-UHFFFAOYSA-N |
| SMILES | Brc1ccc(OCCCCCCOc2ccc(Br)cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~90%
Benzene,1,1'-[1... CAS#:6943-11-9 |
| Literature: Neigenfink, J.; Martin, A.; Wendel, V.; Abraham, W. Journal fuer Praktische Chemie/Chemiker-Zeitung, 1998 , vol. 340, # 7 p. 632 - 641 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |