(6-Nitro-1-oxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid structure
|
Common Name | (6-Nitro-1-oxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 694499-69-9 | Molecular Weight | 236.18100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (6-Nitro-1-oxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8N2O5 |
|---|---|
| Molecular Weight | 236.18100 |
| Exact Mass | 236.04300 |
| PSA | 103.43000 |
| LogP | 1.09630 |
| InChIKey | CGLRVRCSFIJQGS-UHFFFAOYSA-N |
| SMILES | O=C(O)CN1Cc2ccc([N+](=O)[O-])cc2C1=O |
| HS Code | 2918300090 |
|---|
|
~%
(6-Nitro-1-oxo-... CAS#:694499-69-9 |
| Literature: Krysko, Andrei A.; Samoylenko, Georgiy V.; Polishchuk, Pavel G.; Andronati, Sergei A.; Kabanova, Tatyana A.; Khristova, Tetiana M.; Kuz'Min, Victor E.; Kabanov, Vladimir M.; Krysko, Olga L.; Varnek, Alexandre A.; Grygorash, Ruslan Ya. Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 19 p. 5971 - 5974 |
|
~%
(6-Nitro-1-oxo-... CAS#:694499-69-9 |
| Literature: Krysko, Andrei A.; Samoylenko, Georgiy V.; Polishchuk, Pavel G.; Andronati, Sergei A.; Kabanova, Tatyana A.; Khristova, Tetiana M.; Kuz'Min, Victor E.; Kabanov, Vladimir M.; Krysko, Olga L.; Varnek, Alexandre A.; Grygorash, Ruslan Ya. Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 19 p. 5971 - 5974 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (6-morpholino-7(9)H-purin-2-yl)-hydrazine |
| (6-N,N-dimethylaminofulvene)tricarbonyltungsten |
| (6-nitro-1-oxo-1,3-dihydroisoindol-2-yl)acetic acid |