2,2-dichloro-N-[10-[(2,2-dichloroacetyl)amino]decyl]acetamide structure
|
Common Name | 2,2-dichloro-N-[10-[(2,2-dichloroacetyl)amino]decyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 6945-00-2 | Molecular Weight | 394.16500 | |
| Density | 1.24g/cm3 | Boiling Point | 536.5ºC at 760 mmHg | |
| Molecular Formula | C14H24Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.3ºC | |
| Name | Heptane,1,1,6-trichloro |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 536.5ºC at 760 mmHg |
| Molecular Formula | C14H24Cl4N2O2 |
| Molecular Weight | 394.16500 |
| Flash Point | 278.3ºC |
| Exact Mass | 392.05900 |
| PSA | 58.20000 |
| LogP | 4.72880 |
| Index of Refraction | 1.5 |
| InChIKey | XYHQZLTUPAFAAF-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCCCCCCCNC(=O)C(Cl)Cl)C(Cl)Cl |
|
~%
2,2-dichloro-N-... CAS#:6945-00-2 |
| Literature: Surrey,A.R.; Mayer,J.R. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 3, p. 419 - 425 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1,6-trichloro-heptane |
| 1.10-Bis-dichloracetylmino-decn |
| 1.1.6-Trichlorheptan |