Methyl 3-(4-Methyl-3-nitro-N-(pyridin-2-yl)benzamido)propanoate structure
|
Common Name | Methyl 3-(4-Methyl-3-nitro-N-(pyridin-2-yl)benzamido)propanoate | ||
|---|---|---|---|---|
| CAS Number | 694517-54-9 | Molecular Weight | 343.33400 | |
| Density | 1.314g/cm3 | Boiling Point | 536.4ºC at 760 mmHg | |
| Molecular Formula | C17H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2ºC | |
| Name | methyl 3-[(4-methyl-3-nitrobenzoyl)-pyridin-2-ylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 536.4ºC at 760 mmHg |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.33400 |
| Flash Point | 278.2ºC |
| Exact Mass | 343.11700 |
| PSA | 105.32000 |
| LogP | 3.03130 |
| Index of Refraction | 1.61 |
| InChIKey | BKYNVISGQMGZGT-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN(C(=O)c1ccc(C)c([N+](=O)[O-])c1)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms2627e07 |