[1,1'-Biphenyl]-4,4'-diamine,2,2'-dibromo-5,5'-dimethoxy- structure
|
Common Name | [1,1'-Biphenyl]-4,4'-diamine,2,2'-dibromo-5,5'-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 6948-51-2 | Molecular Weight | 402.08100 | |
| Density | 1.677g/cm3 | Boiling Point | 448.1ºC at 760 mmHg | |
| Molecular Formula | C14H14Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.8ºC | |
| Name | 4-(4-amino-2-bromo-5-methoxyphenyl)-5-bromo-2-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.677g/cm3 |
|---|---|
| Boiling Point | 448.1ºC at 760 mmHg |
| Molecular Formula | C14H14Br2N2O2 |
| Molecular Weight | 402.08100 |
| Flash Point | 224.8ºC |
| Exact Mass | 399.94200 |
| PSA | 70.50000 |
| LogP | 5.22260 |
| Index of Refraction | 1.656 |
| InChIKey | UYCWJJAOVFTDAC-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(OC)c(N)cc2Br)c(Br)cc1N |
|
~%
[1,1'-Biphenyl]... CAS#:6948-51-2 |
| Literature: Raiford; Bren Journal of the American Chemical Society, 1929 , vol. 51, p. 2540 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6.6'-Dibrom-o-dianisidin |
| 2,2'-dibromo-5,5'-dimethoxybiphenyl-4,4'-diamine |
| 2,2'-Dibrom-5,5'-dimethoxy-benzidin |
| 2,2'-dibromo-5,5'-dimethoxy-benzidine |
| 6.6'-Dibrom-4.4'-diamino-3.3'-dimethoxy-diphenyl |