4-Bromo-1-methoxy-2-nitrobenzene structure
|
Common Name | 4-Bromo-1-methoxy-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 33696-00-3 | Molecular Weight | 232.031 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 303.3±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H6BrNO3 | Melting Point | 87ºC | |
| MSDS | USA | Flash Point | 137.2±22.3 °C | |
| Name | 4-bromo-1-methoxy-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.3±22.0 °C at 760 mmHg |
| Melting Point | 87ºC |
| Molecular Formula | C7H6BrNO3 |
| Molecular Weight | 232.031 |
| Flash Point | 137.2±22.3 °C |
| Exact Mass | 230.953094 |
| PSA | 55.05000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | ORBHQHXVVMZIDP-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Bromo-2-nitroanisole |
| 2-nitro-4-bromoanisole |
| 4-Bromo-2-nitrophenyl methyl ether |
| 3-nitro-4-methoxy bromobenzene |
| EINECS 251-642-5 |
| 4-brom-2-nitroanisole |
| MFCD00055529 |
| 4-Bromo-1-methoxy-2-nitrobenzene |
| Benzene, 4-bromo-1-methoxy-2-nitro- |
| 4-methoxy-3-nitrophenyl bromide |
| 4-methoxy-3-nitrobromobenzene |
| 4-bromo-2-nitro-anisole |
| 4-bromo-1-methoxy-2-nitro-benzene |
| 2-methoxy-5-bromonitrobenzene |