Benzeneethanol,4-nitro-, 1-(4-methylbenzenesulfonate) structure
|
Common Name | Benzeneethanol,4-nitro-, 1-(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 6948-72-7 | Molecular Weight | 321.34800 | |
| Density | 1.322 g/cm3 | Boiling Point | 508.8ºC at 760 mmHg | |
| Molecular Formula | C15H15NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
| Name | 2-(4-nitrophenyl)ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322 g/cm3 |
|---|---|
| Boiling Point | 508.8ºC at 760 mmHg |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.34800 |
| Flash Point | 261.5ºC |
| Exact Mass | 321.06700 |
| PSA | 97.57000 |
| LogP | 4.45520 |
| Index of Refraction | 1.589 |
| InChIKey | BOMBDNFTAICOPN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2906299090 |
|---|
|
~88%
Benzeneethanol,... CAS#:6948-72-7 |
| Literature: WARNER-LAMBERT COMPANY LLC Patent: WO2004/41793 A1, 2004 ; Location in patent: Page 35 ; WO 2004/041793 A1 |
|
~%
Benzeneethanol,... CAS#:6948-72-7 |
| Literature: Schadt,F.L. et al. Journal of the American Chemical Society, 1978 , vol. 100, p. 228 - 246 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-nitrophenethyl tosylate |
| Toluol-4-sulfonsaeure-<4-nitro-phenaethylester> |