4-Nitrophenethyl alcohol structure
|
Common Name | 4-Nitrophenethyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 100-27-6 | Molecular Weight | 167.162 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 301.8±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 59-62 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 144.5±9.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitrobenzeneethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.8±0.0 °C at 760 mmHg |
| Melting Point | 59-62 °C(lit.) |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 144.5±9.4 °C |
| Exact Mass | 167.058243 |
| PSA | 66.05000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | IKMXRUOZUUKSON-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCO)cc1 |
| Storage condition | 2-8°C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant;Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S22-S24/25-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | SG8602000 |
| HS Code | 2906299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Structure-activity relationships of a novel pyranopyridine series of Gram-negative bacterial efflux pump inhibitors.
Bioorg. Med. Chem. 23(9) , 2024-34, (2015) Recently we described a novel pyranopyridine inhibitor (MBX2319) of RND-type efflux pumps of the Enterobacteriaceae. MBX2319 (3,3-dimethyl-5-cyano-8-morpholino-6-(phenethylthio)-3,4-dihydro-1H-pyrano[... |
|
|
Significant levels of extracellular reactive oxygen species produced by brown rot basidiomycetes on cellulose.
FEBS Lett. 531(3) , 483-8, (2002) It is often proposed that brown rot basidiomycetes use extracellular reactive oxygen species (ROS) to accomplish the initial depolymerization of cellulose in wood, but little evidence has been present... |
|
|
J. Org. Chem. 59 , 537, (1994)
|
| 2-(4-Nitrophenyl)ethyl Alcohol |
| 4-Nitrobenzeneethanol |
| Benzeneethanol, 4-nitro- |
| 4-Nitrophenethyl Alcohol |
| EINECS 202-835-8 |
| MFCD00010202 |
| 2-(4-Nitrophenyl)ethanol |
| 2-(4-Nitro-phenyl)-ethanol |