2-formamido-3-(4-nitrophenyl)propanoic acid structure
|
Common Name | 2-formamido-3-(4-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6949-60-6 | Molecular Weight | 238.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-formamido-3-(4-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N2O5 |
|---|---|
| Molecular Weight | 238.19700 |
| Exact Mass | 238.05900 |
| PSA | 112.22000 |
| LogP | 1.88650 |
| InChIKey | BCHSIWCEGQTUHG-UHFFFAOYSA-N |
| SMILES | O=CNC(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
|
~%
2-formamido-3-(... CAS#:6949-60-6 |
| Literature: Bergel; Stock Journal of the Chemical Society, 1954 , p. 2409,2414 Journal of the Chemical Society, 1959 , p. 90,93 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-formyl-4-nitro-phenylalanine |