2-acetamido-3-(4-nitrophenyl)propanoic acid structure
|
Common Name | 2-acetamido-3-(4-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 17363-92-7 | Molecular Weight | 252.22300 | |
| Density | 1.366 g/cm3 | Boiling Point | 554.7ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.3ºC | |
| Name | 2-acetamido-3-(4-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366 g/cm3 |
|---|---|
| Boiling Point | 554.7ºC at 760 mmHg |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.22300 |
| Flash Point | 289.3ºC |
| Exact Mass | 252.07500 |
| PSA | 112.22000 |
| LogP | 1.64070 |
| Vapour Pressure | 3.86E-13mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | SOPVYCYKWGPONA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Acetyl-4-nitro-L-phenylalanin |
| Phenylalanine,N-acetyl-4-nitro |
| N-acetyl-4-nitro-L-phenylalanine |
| Ac-Nitrophe-OH |
| ac-p-nitrophenylalanine |
| D-Phenylalanine,N-acetyl-4-nitro |