1(3H)-Isobenzofuranone,3-(1,3-dimethyl-1H-indol-2-yl)- structure
|
Common Name | 1(3H)-Isobenzofuranone,3-(1,3-dimethyl-1H-indol-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 6951-67-3 | Molecular Weight | 277.31700 | |
| Density | 1.25g/cm3 | Boiling Point | 487.7ºC at 760 mmHg | |
| Molecular Formula | C18H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7ºC | |
| Name | 3-(1,3-dimethylindol-2-yl)-3H-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 487.7ºC at 760 mmHg |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.31700 |
| Flash Point | 248.7ºC |
| Exact Mass | 277.11000 |
| PSA | 31.23000 |
| LogP | 3.74650 |
| Index of Refraction | 1.654 |
| InChIKey | NTQQWNSXWGMDPW-UHFFFAOYSA-N |
| SMILES | Cc1c(C2OC(=O)c3ccccc32)n(C)c2ccccc12 |
|
~%
1(3H)-Isobenzof... CAS#:6951-67-3 |
| Literature: Rees,C.W.; Sabet,C.R. Journal of the Chemical Society, 1965 , p. 680 - 687 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Dimethyl-2-phthalidyl-indol |