4-Pyrimidinecarboxylicacid, 1,2,3,6-tetrahydro-6-oxo-2-thioxo structure
|
Common Name | 4-Pyrimidinecarboxylicacid, 1,2,3,6-tetrahydro-6-oxo-2-thioxo | ||
|---|---|---|---|---|
| CAS Number | 6953-78-2 | Molecular Weight | 172.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-oxo-2-sulfanylidene-1H-pyrimidine-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H4N2O3S |
|---|---|
| Molecular Weight | 172.16200 |
| Exact Mass | 171.99400 |
| PSA | 118.04000 |
| LogP | 0.13070 |
| InChIKey | ISOQUWRYYNKKGX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)[nH]c(=S)[nH]1 |
| HS Code | 2933599090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
| 2-Thiouracil-4-carboxylic acid |
| 2-thioisoorotic acid |
| 6-carboxy-2-thiouracil |
| 2-thioorotate |
| 6-oxo-2-thioxo-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid |
| 2-Thioorotic acid |
| Mercaptoorotic acid |
| 2-thio-6-carboxyuracil |