(4E)-4-[(6-morpholin-4-ylpyridazin-3-yl)hydrazinylidene]pentanoic acid structure
|
Common Name | (4E)-4-[(6-morpholin-4-ylpyridazin-3-yl)hydrazinylidene]pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 69579-09-5 | Molecular Weight | 293.32200 | |
| Density | 1.366g/cm3 | Boiling Point | 585.657ºC at 760 mmHg | |
| Molecular Formula | C13H19N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.994ºC | |
| Name | (4E)-4-[(6-morpholin-4-ylpyridazin-3-yl)hydrazinylidene]pentanoic acid |
|---|
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 585.657ºC at 760 mmHg |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.32200 |
| Flash Point | 307.994ºC |
| Exact Mass | 293.14900 |
| PSA | 103.17000 |
| LogP | 0.45270 |
| Index of Refraction | 1.63 |
| InChIKey | LLFGGVHGZKSKQJ-GXDHUFHOSA-N |
| SMILES | CC(CCC(=O)O)=NNc1ccc(N2CCOCC2)nn1 |
|
~61%
(4E)-4-[(6-morp... CAS#:69579-09-5 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |