Phenol,4,4'-thiazolo[5,4-d]thiazole-2,5-diylbis[2-methoxy- (7CI,8CI,9CI) structure
|
Common Name | Phenol,4,4'-thiazolo[5,4-d]thiazole-2,5-diylbis[2-methoxy- (7CI,8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 6961-99-5 | Molecular Weight | 386.44500 | |
| Density | 1.54g/cm3 | Boiling Point | 562ºC at 760mmHg | |
| Molecular Formula | C18H14N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.7ºC | |
| Name | (4Z)-2-methoxy-4-[(5E)-5-(3-methoxy-4-oxocyclohexa-2,5-dien-1-ylidene)-3,6-dihydro-[1,3]thiazolo[5,4-d][1,3]thiazol-2-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 562ºC at 760mmHg |
| Molecular Formula | C18H14N2O4S2 |
| Molecular Weight | 386.44500 |
| Flash Point | 293.7ºC |
| Exact Mass | 386.03900 |
| PSA | 141.18000 |
| LogP | 4.51520 |
| Index of Refraction | 1.746 |
| InChIKey | DKUNOJAKNUTPPS-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2nc3sc(-c4ccc(O)c(OC)c4)nc3s2)ccc1O |
|
~%
Phenol,4,4'-thi... CAS#:6961-99-5 |
| Literature: Fikrat,H.T.; Oneto,J.F. Journal of Pharmaceutical Sciences, 1962 , vol. 51, p. 527 - 529 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2.5-Bis-<4-hydroxy-3-methoxy-phenyl>-thiazolo<5.4-d>thiazol |