4-(2-Phenyl-2-propanyl)aniline structure
|
Common Name | 4-(2-Phenyl-2-propanyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 6962-10-3 | Molecular Weight | 211.30200 | |
| Density | 1.03g/cm3 | Boiling Point | 341.9ºC at 760mmHg | |
| Molecular Formula | C15H17N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | 1-benzhydryl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 341.9ºC at 760mmHg |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.30200 |
| Flash Point | 167.3ºC |
| Exact Mass | 211.13600 |
| PSA | 26.02000 |
| LogP | 4.17590 |
| Index of Refraction | 1.584 |
| InChIKey | MSKAVHSHJVKFBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c1ccc(N)cc1 |
| HS Code | 2921420090 |
|---|
|
~78%
4-(2-Phenyl-2-p... CAS#:6962-10-3 |
| Literature: Ciba-Geigy Corporation Patent: US4436936 A1, 1984 ; |
|
~%
4-(2-Phenyl-2-p... CAS#:6962-10-3 |
| Literature: Van Walree, Cornelis A.; Roest, Martin R.; Schuddeboom, Wouter; Jenneskens, Leonardus W.; Verhoeven, Jan W.; Warman, John M.; Kooijman, Huub; Spek, Anthony L. Journal of the American Chemical Society, 1996 , vol. 118, # 35 p. 8395 - 8407 |
|
~%
4-(2-Phenyl-2-p... CAS#:6962-10-3 |
| Literature: Van Walree, Cornelis A.; Roest, Martin R.; Schuddeboom, Wouter; Jenneskens, Leonardus W.; Verhoeven, Jan W.; Warman, John M.; Kooijman, Huub; Spek, Anthony L. Journal of the American Chemical Society, 1996 , vol. 118, # 35 p. 8395 - 8407 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine,4-(1-methyl-1-phenylethyl)- |
| BENZOIC ACID,4-(2-BUTENYLOXY)-3,5-DIPROPYL |
| 4-(2-Butenyloxy)-3,5-dipropylbenzoic acid |
| 4-(2-phenylpropan-2-yl)benzenamine |
| 4-(2-Phenylpropan-2-yl)aniline |
| 4-Crotoxy-3.5-dipropyl-benzoesaeure |
| 4-Crotoxy-3,5-dipropylbenzoic acid |
| 4-cumyl-aniline |