4-[4-(2-Phenyl-2-propanyl)phenoxy]phthalonitrile structure
|
Common Name | 4-[4-(2-Phenyl-2-propanyl)phenoxy]phthalonitrile | ||
|---|---|---|---|---|
| CAS Number | 83482-57-9 | Molecular Weight | 338.402 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 508.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H18N2O | Melting Point | 91ºC | |
| MSDS | Chinese USA | Flash Point | 189.9±23.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[4-(2-phenylpropan-2-yl)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.7±50.0 °C at 760 mmHg |
| Melting Point | 91ºC |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.402 |
| Flash Point | 189.9±23.0 °C |
| Exact Mass | 338.141907 |
| PSA | 56.81000 |
| LogP | 6.46 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | IANCXVAWMHHHKK-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2ccc(C#N)c(C#N)c2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
|
~96%
4-[4-(2-Phenyl-... CAS#:83482-57-9 |
| Literature: Takagi, Yasufumi; Ohta, Kazuchika; Shimosugi, Shota; Fujii, Tatsuya; Itoh, Eiji Journal of Materials Chemistry, 2012 , vol. 22, # 29 p. 14418 - 14425 |
|
~%
4-[4-(2-Phenyl-... CAS#:83482-57-9 |
| Literature: Journal of Organic Chemistry, , vol. 55, # 7 p. 2155 - 2159 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(4-(1-Methyl-1-phenylethyl)phenoxy)phthalonitrile |
| 1,2-Benzenedicarbonitrile, 4-[4-(1-methyl-1-phenylethyl)phenoxy]- |
| 4-[4-(2-Phenyl-2-propanyl)phenoxy]phthalonitrile |
| 4-[4-(2-phenylpropan-2-yl)phenoxy]phthalonitrile |