6-chloro-1-decyl-quinoline structure
|
Common Name | 6-chloro-1-decyl-quinoline | ||
|---|---|---|---|---|
| CAS Number | 6962-34-1 | Molecular Weight | 431.78200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27ClIN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-1-decylquinolin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H27ClIN |
|---|---|
| Molecular Weight | 431.78200 |
| Exact Mass | 431.08800 |
| PSA | 3.88000 |
| LogP | 2.92540 |
| InChIKey | GOWPICDZRGISHB-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[n+]1cccc2cc(Cl)ccc21.[I-] |
|
~%
6-chloro-1-decy... CAS#:6962-34-1 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Chlor-1-decyl-chinolinium,Jodid |
| 6-chloro-1-decyl-quinolinium,iodide |