Borinic acid,bis(4-bromophenyl)-, 2-aminoethyl ester (9CI) structure
|
Common Name | Borinic acid,bis(4-bromophenyl)-, 2-aminoethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6962-82-9 | Molecular Weight | 382.88600 | |
| Density | 1.58g/cm3 | Boiling Point | 402.3ºC at 760mmHg | |
| Molecular Formula | C14H14BBr2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1ºC | |
| Name | 2-bis(4-bromophenyl)boranyloxyethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 402.3ºC at 760mmHg |
| Molecular Formula | C14H14BBr2NO |
| Molecular Weight | 382.88600 |
| Flash Point | 197.1ºC |
| Exact Mass | 380.95400 |
| PSA | 35.25000 |
| LogP | 2.99290 |
| Index of Refraction | 1.623 |
| InChIKey | LIVGDZGTCZFOGO-UHFFFAOYSA-N |
| SMILES | NCCOB(c1ccc(Br)cc1)c1ccc(Br)cc1 |
|
~%
Borinic acid,bi... CAS#:6962-82-9 |
| Literature: Letsinger; Skoog Journal of the American Chemical Society, 1955 , vol. 77, p. 2491,2492,2494 |
|
~%
Borinic acid,bi... CAS#:6962-82-9 |
| Literature: Coates,G.E.; Livingstone,J.G. Journal of the Chemical Society, 1961 , p. 4909 - 4911 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Di-p-bromphenylborinsaeure-2-amino-ethylester |