4H-1,3-Benzoxazin-4-one,2-[1-[(dimethylamino)methyl]cyclohexyl]-2,3-dihydro- structure
|
Common Name | 4H-1,3-Benzoxazin-4-one,2-[1-[(dimethylamino)methyl]cyclohexyl]-2,3-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 6965-20-4 | Molecular Weight | 288.38500 | |
| Density | 1.11g/cm3 | Boiling Point | 470.5ºC at 760mmHg | |
| Molecular Formula | C17H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.4ºC | |
| Name | 2-[1-[(dimethylamino)methyl]cyclohexyl]-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760mmHg |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.38500 |
| Flash Point | 238.4ºC |
| Exact Mass | 288.18400 |
| PSA | 41.57000 |
| LogP | 2.97580 |
| Index of Refraction | 1.545 |
| InChIKey | PSQYDTBPLXMLJO-UHFFFAOYSA-N |
| SMILES | CN(C)CC1(C2NC(=O)c3ccccc3O2)CCCCC1 |
|
~%
4H-1,3-Benzoxaz... CAS#:6965-20-4 |
| Literature: Horrom; Zaugg Journal of the American Chemical Society, 1950 , vol. 72, p. 721,722 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(1-dimethylaminomethyl-cyclohexyl)-2,3-dihydro-benz[e][1,3]oxazin-4-one |
| 2-{1-[(dimethylamino)methyl]cyclohexyl}-2,3-dihydro-4h-1,3-benzoxazin-4-one |