Quinazoline,4-methyl-2-(4-morpholinylmethyl)-, 3-oxide structure
|
Common Name | Quinazoline,4-methyl-2-(4-morpholinylmethyl)-, 3-oxide | ||
|---|---|---|---|---|
| CAS Number | 6965-80-6 | Molecular Weight | 259.30400 | |
| Density | 1.28g/cm3 | Boiling Point | 462.2ºC at 760 mmHg | |
| Molecular Formula | C14H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | 4-[(4-methyl-3-oxidoquinazolin-3-ium-2-yl)methyl]morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 462.2ºC at 760 mmHg |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.30400 |
| Flash Point | 233.3ºC |
| Exact Mass | 259.13200 |
| PSA | 50.82000 |
| LogP | 1.74180 |
| Index of Refraction | 1.637 |
| InChIKey | AZFFLRNZLXOHRI-UHFFFAOYSA-N |
| SMILES | Cc1c2ccccc2nc(CN2CCOCC2)[n+]1[O-] |
|
~%
Quinazoline,4-m... CAS#:6965-80-6 |
| Literature: Smith Broadbent,H. et al. Journal of Heterocyclic Chemistry, 1977 , vol. 14, p. 289 - 297 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methyl-2-morpholin-4-ylmethyl-quinazoline 3-oxide |