Poly(Vinyl Silsesquioxane) structure
|
Common Name | Poly(Vinyl Silsesquioxane) | ||
|---|---|---|---|---|
| CAS Number | 69655-76-1 | Molecular Weight | 633.03900 | |
| Density | 1.22g/cm3 | Boiling Point | 329.4ºC at 760mmHg | |
| Molecular Formula | C16H24O12Si8 | Melting Point | >350ºC | |
| MSDS | Chinese USA | Flash Point | 148.4ºC | |
| Name | PSS-Octavinyl substituted |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 329.4ºC at 760mmHg |
| Melting Point | >350ºC |
| Molecular Formula | C16H24O12Si8 |
| Molecular Weight | 633.03900 |
| Flash Point | 148.4ºC |
| Exact Mass | 631.94200 |
| PSA | 110.76000 |
| LogP | 1.56640 |
| Index of Refraction | 1.511 |
| InChIKey | ZWCNRMDCQDJIRL-UHFFFAOYSA-N |
| SMILES | C=C[Si]12O[Si]3(C=C)O[Si]4(C=C)O[Si](C=C)(O1)O[Si]1(C=C)O[Si](C=C)(O2)O[Si](C=C)(O3)O[Si](C=C)(O4)O1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 22-24/25-37/39-26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Biomimetic and nanostructured hybrid bioactive glass.
Biomaterials 50 , 1-9, (2015) Inspired by nature's toughening mechanisms, we designed a new polyhedral oligomeric silsesquioxane (POSS)-derived hybrid glass (PHG) that has covalent interactions on the molecular scale between the i... |
| MFCD00217613 |
| Octa(vinylsilasesquioxane) |
| Poly(Vinyl Silsesquioxane) |