4-bromo-N-(4-bromobenzoyl)benzohydrazide structure
|
Common Name | 4-bromo-N-(4-bromobenzoyl)benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 69673-99-0 | Molecular Weight | 398.04900 | |
| Density | 1.727g/cm3 | Boiling Point | 587.5ºC at 760 mmHg | |
| Molecular Formula | C14H10Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.1ºC | |
| Name | N,N'-bis(4-aminophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.727g/cm3 |
|---|---|
| Boiling Point | 587.5ºC at 760 mmHg |
| Molecular Formula | C14H10Br2N2O2 |
| Molecular Weight | 398.04900 |
| Flash Point | 309.1ºC |
| Exact Mass | 395.91100 |
| PSA | 58.20000 |
| LogP | 4.06820 |
| Index of Refraction | 1.647 |
| InChIKey | OJCDNDVAJJIWRW-UHFFFAOYSA-N |
| SMILES | O=C(NNC(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
|
~89%
4-bromo-N-(4-br... CAS#:69673-99-0 |
| Literature: Wu, Chia-Shing; Wu, Juin-Wei; Chen, Yun Journal of Materials Chemistry, 2012 , vol. 22, # 45 p. 23877 - 23884 |
|
~10%
4-bromo-N-(4-br... CAS#:69673-99-0 |
| Literature: Wang, Hui; Ryu, Jeong-Tak; Han, Yoon Soo; Kim, Dae-Hwan; Choi, Byeong Dae; Kwon, Younghwan Molecular Crystals and Liquid Crystals, 2007 , vol. 463, # 1 p. 3 - 13 |
|
~%
4-bromo-N-(4-br... CAS#:69673-99-0 |
| Literature: Zhan, Xiaowei; Liu, Yunqi; Wu, Xia; Wang, Shuai; Zhu, Daoben Macromolecules, 2002 , vol. 35, # 7 p. 2529 - 2537 |
| N,N'-Bis-(4-brom-benzoyl)-hydrazin |
| 1,3-bis-(4-amino-phenyl)-urea |
| bis(4-bromophenyl)hydrazine |
| Carbanilide,4'-diamino |
| 1,2-bis(4-bromobenzoyl)hydrazine |
| 1,3-Bis(p-aminophenyl)urea |
| N,N'-bis-(4-bromo-benzoyl)-hydrazine |
| 4,4'-diaminodiphenylurea |
| N,N'-bis(4-bromobenzyl)hydrazide |