2,4,6-tris(trichloromethyl)pyridine structure
|
Common Name | 2,4,6-tris(trichloromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 6969-50-2 | Molecular Weight | 431.18500 | |
| Density | 1.822g/cm3 | Boiling Point | 367.5ºC at 760 mmHg | |
| Molecular Formula | C8H2Cl9N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | 2,4,6-tris(trichloromethyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.822g/cm3 |
|---|---|
| Boiling Point | 367.5ºC at 760 mmHg |
| Molecular Formula | C8H2Cl9N |
| Molecular Weight | 431.18500 |
| Flash Point | 207.6ºC |
| Exact Mass | 426.73800 |
| PSA | 12.89000 |
| LogP | 6.56170 |
| Index of Refraction | 1.604 |
| InChIKey | ZKYACIXSMBGRQP-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)c1cc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)c1 |
|
~%
2,4,6-tris(tric... CAS#:6969-50-2 |
| Literature: McBee et al. Industrial and Engineering Chemistry, 1947 , vol. 39, p. 389 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4,6-Tris-trichlormethyl-pyridin |
| 2,4,6-tris-trichloromethyl-pyridine |