1,3-Isobenzofurandione,3a,7a-dihydro-4,5,6,7-tetraphenyl structure
|
Common Name | 1,3-Isobenzofurandione,3a,7a-dihydro-4,5,6,7-tetraphenyl | ||
|---|---|---|---|---|
| CAS Number | 6971-41-1 | Molecular Weight | 454.51500 | |
| Density | 1.262g/cm3 | Boiling Point | 689.6ºC at 760 mmHg | |
| Molecular Formula | C32H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350ºC | |
| Name | 4,5,6,7-tetraphenyl-3a,7a-dihydro-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 689.6ºC at 760 mmHg |
| Molecular Formula | C32H22O3 |
| Molecular Weight | 454.51500 |
| Flash Point | 350ºC |
| Exact Mass | 454.15700 |
| PSA | 43.37000 |
| LogP | 6.53780 |
| Index of Refraction | 1.665 |
| InChIKey | SDIBWMJFIDQLCK-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2C(c3ccccc3)=C(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)C12 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Tetraphenyl-3,5-cyclohexadien-1,2-dicarbonsaeureanhydrid |
| 1,2-Dihydro-3,4,5,6-tetraphenylphthalic anhydride |
| 3,4,5,6-tetraphenyl-cyclohexa-3,5-diene-1,2-dicarboxylic acid anhydride |
| 3,4,5,6-Tetraphenyl-1,2-dihydro-phthalsaeure-anhydrid |
| 3,4,5,6-tetraphenyl-1,2-dihydrophthalic anhydride |
| Tetraphenyldihydrophthalsaeureanhydrid |
| 3,4,5,6-tetraphenyl-1,2-dihydro-o-phthalic anhydride |