Acetamide,N-[4-[[4-(formylamino)phenyl]sulfonyl]phenyl]- structure
|
Common Name | Acetamide,N-[4-[[4-(formylamino)phenyl]sulfonyl]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 6973-61-1 | Molecular Weight | 318.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-((4-formamidophenyl)sulfonyl)phenyl)acetamide |
|---|
| Molecular Formula | C15H14N2O4S |
|---|---|
| Molecular Weight | 318.34800 |
| Exact Mass | 318.06700 |
| PSA | 100.72000 |
| LogP | 3.90880 |
| InChIKey | LCGNTHRVBHMBLE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2ccc(NC=O)cc2)cc1 |
|
~%
Acetamide,N-[4-... CAS#:6973-61-1 |
| Literature: Heymann; Heidelberger Journal of the American Chemical Society, 1945 , vol. 67, p. 1986,1989 |
|
~%
Acetamide,N-[4-... CAS#:6973-61-1 |
| Literature: Heymann; Heidelberger Journal of the American Chemical Society, 1945 , vol. 67, p. 1986,1989 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |