2-hydroxy-1,2-diphenyl-3-pyridin-2-yl-propan-1-one structure
|
Common Name | 2-hydroxy-1,2-diphenyl-3-pyridin-2-yl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6974-64-7 | Molecular Weight | 303.35400 | |
| Density | 1.211g/cm3 | Boiling Point | 481.4ºC at 760 mmHg | |
| Molecular Formula | C20H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.9ºC | |
| Name | 2-hydroxy-1,2,3-triphenyl-pentan-1-one |
|---|
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 481.4ºC at 760 mmHg |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.35400 |
| Flash Point | 244.9ºC |
| Exact Mass | 303.12600 |
| PSA | 50.19000 |
| LogP | 3.39480 |
| Index of Refraction | 1.629 |
| InChIKey | ABSVXYFYZVAKMF-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(O)(Cc1ccccn1)c1ccccc1 |
|
~%
2-hydroxy-1,2-d... CAS#:6974-64-7 |
| Literature: McElvain; Johnson Journal of the American Chemical Society, 1941 , vol. 63, p. 2213,2216 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |