2-AMINO-3,5-DIBROMOBENZOPHENONE structure
|
Common Name | 2-AMINO-3,5-DIBROMOBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 69751-74-2 | Molecular Weight | 355.02500 | |
| Density | 1.755 g/cm3 | Boiling Point | 459.7ºCat 760 mmHg | |
| Molecular Formula | C13H9Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-amino-3,5-dibromophenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.755 g/cm3 |
|---|---|
| Boiling Point | 459.7ºCat 760 mmHg |
| Molecular Formula | C13H9Br2NO |
| Molecular Weight | 355.02500 |
| Flash Point | 231.8ºC |
| Exact Mass | 352.90500 |
| PSA | 43.09000 |
| LogP | 4.60600 |
| Index of Refraction | 1.671 |
| InChIKey | IMLLZDZNMSFUSJ-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(Br)cc1C(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 7 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-amino-3,5-dibromo-benzophenone |
| 2-Amino-3,5-dibrom-benzophenon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: LogP of (2-amino-3,5-dibromophenyl)-phenylmethanone is 4.60600. |
| Q: What is the molecular formula of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: Molecular formula of (2-amino-3,5-dibromophenyl)-phenylmethanone is C13H9Br2NO. |
| Q: What is the InChIKey of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: InChIKey of (2-amino-3,5-dibromophenyl)-phenylmethanone is IMLLZDZNMSFUSJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: CAS number of (2-amino-3,5-dibromophenyl)-phenylmethanone is 69751-74-2. |
| Q: What is the polar surface area (PSA) of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: Polar surface area (PSA) of (2-amino-3,5-dibromophenyl)-phenylmethanone is 43.09000. |
| Q: What is the English name of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: The English name of (2-amino-3,5-dibromophenyl)-phenylmethanone is (2-amino-3,5-dibromophenyl)-phenylmethanone. |
| Q: What is the boiling point of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: Boiling point of (2-amino-3,5-dibromophenyl)-phenylmethanone is 459.7ºCat 760 mmHg. |
| Q: What is the molecular weight of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: Molecular weight of (2-amino-3,5-dibromophenyl)-phenylmethanone is 355.02500. |
| Q: What English synonyms does (2-amino-3,5-dibromophenyl)-phenylmethanone have? |
| A: English synonyms of (2-amino-3,5-dibromophenyl)-phenylmethanone: 2-amino-3,5-dibromo-benzophenone, 2-Amino-3,5-dibrom-benzophenon. |
| Q: What are the upstream materials of (2-amino-3,5-dibromophenyl)-phenylmethanone? |
| A: Related upstream materials(CAS) of (2-amino-3,5-dibromophenyl)-phenylmethanone: 39859-36-4;5840-40-4;88092-64-2;2835-77-0;885-34-7;5176-14-7;2243-79-0;552-89-6;7726-95-6;79-34-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |