2,7-Dichloro-Alpha-[(Dibutylamino)Methyl]-9H-Fluorene-4-Methanol structure
|
Common Name | 2,7-Dichloro-Alpha-[(Dibutylamino)Methyl]-9H-Fluorene-4-Methanol | ||
|---|---|---|---|---|
| CAS Number | 69759-61-1 | Molecular Weight | 406.388 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 546.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H29Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.1±30.1 °C | |
| Name | 2,7-Dichloro-Alpha-[(Dibutylamino)Methyl]-9H-Fluorene-4-Methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.2±50.0 °C at 760 mmHg |
| Molecular Formula | C23H29Cl2NO |
| Molecular Weight | 406.388 |
| Flash Point | 284.1±30.1 °C |
| Exact Mass | 405.162628 |
| PSA | 23.47000 |
| LogP | 7.72 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | DALUOHFKVYCDCW-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CC(O)c1cc(Cl)cc2c1-c1ccc(Cl)cc1C2 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(Dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol |
| 9H-Fluorene-4-methanol, 2,7-dichloro-α-[(dibutylamino)methyl]- |
| 2, 7-DICHLORO-A-(DIBUTYLAMINO) METHYL-9H-FLUORENE-4-METHANOL |