2,7-Dichlorofluorene structure
|
Common Name | 2,7-Dichlorofluorene | ||
|---|---|---|---|---|
| CAS Number | 7012-16-0 | Molecular Weight | 235.109 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 370.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H8Cl2 | Melting Point | 126-128 | |
| MSDS | N/A | Flash Point | 185.3±19.5 °C | |
| Name | 2,7-Dichlorofluorene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.7±35.0 °C at 760 mmHg |
| Melting Point | 126-128 |
| Molecular Formula | C13H8Cl2 |
| Molecular Weight | 235.109 |
| Flash Point | 185.3±19.5 °C |
| Exact Mass | 234.000305 |
| LogP | 5.35 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.660 |
| InChIKey | SDPURBHAHVFTGX-UHFFFAOYSA-N |
| SMILES | Clc1ccc2c(c1)Cc1cc(Cl)ccc1-2 |
| Storage condition | Refrigerator |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2942000000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,7-dichlor-9h-fluoren |
| 2,7-dichloro-9H-fluorene |
| MFCD00032840 |