Methyl 6-fluoro-1H-indazole-4-carboxylate structure
|
Common Name | Methyl 6-fluoro-1H-indazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 697739-05-2 | Molecular Weight | 194.163 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 357.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C9H7FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1±23.7 °C | |
| Name | methyl 6-fluoro-1H-indazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.6±27.0 °C at 760 mmHg |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.163 |
| Flash Point | 170.1±23.7 °C |
| Exact Mass | 194.049149 |
| PSA | 54.98000 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | HLNVECDTQXVGPS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(F)cc2[nH]ncc12 |
| Hazard Codes | Xi |
|---|
|
~26%
Methyl 6-fluoro... CAS#:697739-05-2 |
| Literature: Merck Sharp and Dohme Limited Patent: WO2004/46133 A1, 2004 ; Location in patent: Page 30 ; WO 2004/046133 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Methyl 6-fluoro-1H-indazole-4-carboxylate |
| 6-Fluoro-4-indazolecarboxylic acid methyl ester |
| 1H-Indazole-4-carboxylic acid, 6-fluoro-, methyl ester |