5,8-bis[2-(dimethylamino)ethylamino]-1,2-dihydroxyanthracene-9,10-dione structure
|
Common Name | 5,8-bis[2-(dimethylamino)ethylamino]-1,2-dihydroxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 69837-16-7 | Molecular Weight | 412.48200 | |
| Density | 1.337g/cm3 | Boiling Point | 643.4ºC at 760 mmHg | |
| Molecular Formula | C22H28N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.9ºC | |
| Name | 5,8-bis[2-(dimethylamino)ethylamino]-1,2-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 643.4ºC at 760 mmHg |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.48200 |
| Flash Point | 342.9ºC |
| Exact Mass | 412.21100 |
| PSA | 105.14000 |
| LogP | 1.96620 |
| Index of Refraction | 1.682 |
| InChIKey | FJSGMFGNISZAGK-UHFFFAOYSA-N |
| SMILES | CN(C)CCNc1ccc(NCCN(C)C)c2c1C(=O)c1ccc(O)c(O)c1C2=O |
|
~%
5,8-bis[2-(dime... CAS#:69837-16-7 |
| Literature: Murdock,K.C. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 9 p. 1024 - 1030 |
|
~%
5,8-bis[2-(dime... CAS#:69837-16-7 |
| Literature: Murdock,K.C. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 9 p. 1024 - 1030 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,8-Bis((2-(dimethylamino)ethyl)amino)-1,2-dihydroxy-9,10-anthracenedione |
| 1,4-Bis[(2-dimethylaminoethyl)amino]-5,6-dihydroxy-anthraquinone |
| 9,10-Anthracenedione,5,8-bis((2-(dimethylamino)ethyl)amino)-1,2-dihydroxy |
| 5,8-bis(2-dimethylaminoethylamino)-1,2-dihydroxyanthracene-9,10-dione |