2-Bromo-1-(4-ethylphenyl)-2-methylpropan-1-one
Modify Date: 2025-08-27 14:27:45
2-Bromo-1-(4-ethylphenyl)-2-methylpropan-1-one structure
|
Common Name | 2-Bromo-1-(4-ethylphenyl)-2-methylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 698394-60-4 | Molecular Weight | 255.15100 | |
| Density | 1.275 g/cm3 | Boiling Point | 308.3ºC at 760 mmHg | |
| Molecular Formula | C12H15BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 38.5ºC | |
| Name | 2-Bromo-1-(4-ethylphenyl)-2-methylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275 g/cm3 |
|---|---|
| Boiling Point | 308.3ºC at 760 mmHg |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15100 |
| Flash Point | 38.5ºC |
| Exact Mass | 254.03100 |
| PSA | 17.07000 |
| LogP | 3.60520 |
| InChIKey | FRLPHWVDHFBDQG-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)C(C)(C)Br)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:698394-59-1| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-1-(4-ethylphenyl)-2-methylpropane-1-one |