eth 295 structure
|
Common Name | eth 295 | ||
|---|---|---|---|---|
| CAS Number | 69844-41-3 | Molecular Weight | 470.72900 | |
| Density | 0.949g/cm3 | Boiling Point | 573.6ºC at 760 mmHg | |
| Molecular Formula | C27H54N2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 300.7ºC | |
| Name | N-heptyl-3-[3-[3-[heptyl(methyl)amino]-3-oxopropoxy]-2,2-dimethylpropoxy]-N-methylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.949g/cm3 |
|---|---|
| Boiling Point | 573.6ºC at 760 mmHg |
| Molecular Formula | C27H54N2O4 |
| Molecular Weight | 470.72900 |
| Flash Point | 300.7ºC |
| Exact Mass | 470.40800 |
| PSA | 59.08000 |
| LogP | 5.68360 |
| Index of Refraction | 1.469 |
| InChIKey | UZKSGXIBTHOXEO-UHFFFAOYSA-N |
| SMILES | CCCCCCCN(C)C(=O)CCOCC(C)(C)COCCC(=O)N(C)CCCCCCC |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
J. Senkyr et al.
Anal. Chem. 51 , 786, (1979)
|
|
|
P.A. Bertrand et al.
Anal. Chem. 55 , 364, (1983)
|
|
|
E. Malinowska
Analyst 115 , 1085, (1990)
|
| Uranyl ionophore I |
| N,N'-Diheptyl-N,N'-6,6-tetramethyl-4,8-dioxaundecane diamid |
| ETH 295 |
| N,N'-Diheptyl-N,N',6,6-tetramethyl-4,8-dioxaundecanediamide |