FTCNQ structure
|
Common Name | FTCNQ | ||
|---|---|---|---|---|
| CAS Number | 69857-37-0 | Molecular Weight | 222.17700 | |
| Density | 1.38g/cm3 | Boiling Point | 131.6ºC at 760 mmHg | |
| Molecular Formula | C12H3FN4 | Melting Point | 216ºC | |
| MSDS | N/A | Flash Point | 33.4ºC | |
| Name | 2-Fluoro-7,7,8,8-tetracyanoquinodimethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 131.6ºC at 760 mmHg |
| Melting Point | 216ºC |
| Molecular Formula | C12H3FN4 |
| Molecular Weight | 222.17700 |
| Flash Point | 33.4ºC |
| Exact Mass | 222.03400 |
| PSA | 95.16000 |
| LogP | 0.22142 |
| Index of Refraction | 1.585 |
| InChIKey | BXPLEMMFZOKIHP-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=c1ccc(=C(C#N)C#N)c(F)c1 |
| Hazard Codes | Xn |
|---|---|
| RIDADR | UN 3439 6.1/PG 3 |
| HS Code | 2926909090 |
|
~%
FTCNQ CAS#:69857-37-0 |
| Literature: Ferraris,J.P.; Saito,G. Journal of the Chemical Society, Chemical Communications, 1978 , p. 992 - 993 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-[4-(dicyanomethylidene)-3-fluorocyclohexa-2,5-dien-1-ylidene]propanedinitrile |