2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide structure
|
Common Name | 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 69891-92-5 | Molecular Weight | 457.340 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26BrO2P | Melting Point | 193-195 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 193-195 °C(lit.) |
|---|---|
| Molecular Formula | C24H26BrO2P |
| Molecular Weight | 457.340 |
| Exact Mass | 456.085358 |
| PSA | 32.05000 |
| LogP | 1.13760 |
| InChIKey | XETDBHNHTOJWPZ-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc([P+](CCC2OCCCO2)(c2ccccc2)c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
|
~75%
2-(1,3-Dioxan-2... CAS#:69891-92-5 |
| Literature: Ortho-McNeil Pharmaceutical, Inc. Patent: EP906091 B1, 2006 ; Location in patent: Page/Page column 21 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 274-189-5 |
| MFCD00012000 |
| 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium,bromide |
| Phosphonium, [2-(1,3-dioxan-2-yl)ethyl]triphenyl-, bromide (1:1) |
| [2-(1,3-Dioxan-2-yl)ethyl](triphenyl)phosphonium bromide |