2-[16-(2-hydroxyethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethanol structure
|
Common Name | 2-[16-(2-hydroxyethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 69930-74-1 | Molecular Weight | 350.45100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H34N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[16-(2-hydroxyethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H34N2O6 |
|---|---|
| Molecular Weight | 350.45100 |
| Exact Mass | 350.24200 |
| PSA | 83.86000 |
| InChIKey | BLLWTTRFRPIAAV-UHFFFAOYSA-N |
| SMILES | OCCN1CCOCCOCCN(CCO)CCOCCOCC1 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 7,16-bis(2-hydroxyethyl)-1,4,7,13-tetraoxa-7,16-diazacyclooctadecane |
| N,N'-bis-(2-hydroxyethyl)-4,13-diaza-18-crown-6 |
| bis-(2-hydroxyethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
| 1,10-Bis(2-hydroxyethyl)-4,7,13,16-tetraoxa-1,10-diazacyclooctadecane |
| 7,16-bis(2-hydroxyethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |