Triethylene glycol bis(p-toluenesulfonate) structure
|
Common Name | Triethylene glycol bis(p-toluenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 19249-03-7 | Molecular Weight | 458.546 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 608.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H26O8S2 | Melting Point | 78-82 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 321.7±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Triethylene glycol bis(p-toluenesulfonate)Triethylene glycol bis(p-toluenesulfonate) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Triethylene glycol bis(p-toluenesulfonate) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 608.4±55.0 °C at 760 mmHg |
| Melting Point | 78-82 °C(lit.) |
| Molecular Formula | C20H26O8S2 |
| Molecular Weight | 458.546 |
| Flash Point | 321.7±31.5 °C |
| Exact Mass | 458.106903 |
| PSA | 121.96000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | KCONMNWPRXAWKK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
G.W. Gokel, S.H. Korzeniowski
Macrocyclic Polyether Synthesis , (1982)
|
| Ethanol, 2,2'-(1,2-ethanediylbis(oxy))bis-, bis(4-methylbenzenesulfonate) |
| 1,2-Ethanediylbis(oxy-2,1-ethanediyl) bis(4-methylbenzenesulfonate) |
| 2-[2-(2-([(4-Methylphenyl)sulfonyl]oxy)ethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| TRI(ETHYLENE GLYCOL) DI-P-TOLUENESULFONATE |
| ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(4-methylbenzenesulfonate) |
| Triethylene Glycol Bis(p-toluenesulfonate) |
| TsOCH2(CH2OCH2)2CH2OTs |
| Triethylene glycol di(p-toluenesulfonate) |
| Triethylene Glycol Di-p-tosylate |
| triethylene glycol bis(4-toluenesulfonate) |
| 1,2-Bis(2-tosyloxyethoxy)ethane |
| Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis-, bis(4-methylbenzenesulfonate) |
| bis-tosylated triethyleneglycol |
| MFCD00048096 |
| Triethylene glycol ditosylate |
| 1,2-Bis[2-(p-toluenesulfonyloxy)ethoxy]ethane |
| 2,2'-(Ethylenedioxy)diethyl Ditosylate |
| (Ethane-1,2-diylbis(oxy))bis(ethane-2,1-diyl) bis(4-methylbenzenesulfonate) |
| 2-(2-{2-[(4-methylphenyl)sulfonyloxy]ethoxy}ethoxy)ethyl 4-methylbenzenesulfon ate |
| Tos-PEG4-Tos |