N5-(Diaminomethylene)-2-(difluoromethyl)ornithine structure
|
Common Name | N5-(Diaminomethylene)-2-(difluoromethyl)ornithine | ||
|---|---|---|---|---|
| CAS Number | 69955-43-7 | Molecular Weight | 224.21 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 445.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C7H14F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.5±31.5 °C | |
Use of N5-(Diaminomethylene)-2-(difluoromethyl)ornithineDL-α-(Difluoromethyl)arginine is an potent, enzyme-activated and irreversible arginine decarboxylases inhibitor. DL-α-(Difluoromethyl)arginine blocks the arginine decarboxylase activity of E.coli and Pseudomonas aeruginosa in vivo[1]. |
| Name | DL-α-(Difluoromethyl)arginine |
|---|---|
| Synonym | More Synonyms |
| Description | DL-α-(Difluoromethyl)arginine is an potent, enzyme-activated and irreversible arginine decarboxylases inhibitor. DL-α-(Difluoromethyl)arginine blocks the arginine decarboxylase activity of E.coli and Pseudomonas aeruginosa in vivo[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.9±55.0 °C at 760 mmHg |
| Molecular Formula | C7H14F2N4O2 |
| Molecular Weight | 224.21 |
| Flash Point | 223.5±31.5 °C |
| Exact Mass | 224.108475 |
| PSA | 125.22000 |
| LogP | -0.03 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | YEORLXJBCPPSOC-UHFFFAOYSA-N |
| SMILES | NC(N)=NCCCC(N)(C(=O)O)C(F)F |
| DL-a-(Difluoromethyl)arginine |
| 2-(Difluoromethyl)arginine |
| DFMA |
| a-(Difluoromethyl)-DL-arginine |
| N-(Diaminomethylene)-2-(difluoromethyl)ornithine |
| a-Difluoromethylarginine |