NSC-60339 structure
|
Common Name | NSC-60339 | ||
|---|---|---|---|---|
| CAS Number | 70-09-7 | Molecular Weight | 486.95300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H23ClN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NSC-60339NSC-60339, an efflux pump inhibitor and a substrate of AcrAB-TolC, is a polybasic terephthalic acid derivative studied as a potential cancer chemotherapeutic agent[1][2]. |
| Name | 2-chloro-1-N,4-N-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | NSC-60339, an efflux pump inhibitor and a substrate of AcrAB-TolC, is a polybasic terephthalic acid derivative studied as a potential cancer chemotherapeutic agent[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | NSC 60339 has been correlated with the sensitivity, resistance, or cross-resistance of 7 tumor lines to phthalanilide treatment in vivo. The sensitive tumors (L1210, L1210/MTX, L1210/ara-C, and P815) rapidly takes up the drug and retained it primarily as lipid-bound drug for the 24-hr experimental period. The resistant tumor, L1210/NSC 60339, and 2 cross-resistant tumors, P388/VCR and P815/VLB, took up as much drug as the sensitive tumors did by 0.5 hr, but there was an efflux of lipid-bound drug from these resistant tumors by 24 hr[3]. |
| References |
| Molecular Formula | C26H23ClN6O2 |
|---|---|
| Molecular Weight | 486.95300 |
| Exact Mass | 486.15700 |
| PSA | 106.98000 |
| LogP | 3.21900 |
| InChIKey | UJQGBYRKCZQJJS-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C2=NCCN2)cc1)c1ccc(C(=O)Nc2ccc(C3=NCCN3)cc2)c(Cl)c1 |
| Storage condition | -20°C |
| Glycopeptide,3b |
| Wander |
| HR 2198 |