2-chloro-N-(3-chloro-4-methyl-phenyl)benzamide structure
|
Common Name | 2-chloro-N-(3-chloro-4-methyl-phenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 7017-26-7 | Molecular Weight | 280.14900 | |
| Density | 1.343g/cm3 | Boiling Point | 330.9ºC at 760 mmHg | |
| Molecular Formula | C14H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.9ºC | |
| Name | 2-chloro-N-(3-chloro-4-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 330.9ºC at 760 mmHg |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.14900 |
| Flash Point | 153.9ºC |
| Exact Mass | 279.02200 |
| PSA | 29.10000 |
| LogP | 4.62710 |
| Index of Refraction | 1.643 |
| InChIKey | OCJWUINPGKPIAN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccccc2Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
2-chloro-N-(3-c... CAS#:7017-26-7 |
| Literature: Aliev,N.A. et al. J. Gen. Chem. USSR (Engl. Transl.), 1966 , vol. 36, # 4 p. 638 - 639,653 - 654 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Chlor-benzoesaeure-(3-chlor-4-methyl-anilid) |