2,2,3,3-tetramethyl-1,4-bis-(4-methylphenyl)sulfonyloxy-butane structure
|
Common Name | 2,2,3,3-tetramethyl-1,4-bis-(4-methylphenyl)sulfonyloxy-butane | ||
|---|---|---|---|---|
| CAS Number | 70178-81-3 | Molecular Weight | 454.60000 | |
| Density | 1.201g/cm3 | Boiling Point | 584.6ºC at 760 mmHg | |
| Molecular Formula | C22H30O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.3ºC | |
| Name | [2,2,3,3-tetramethyl-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 584.6ºC at 760 mmHg |
| Molecular Formula | C22H30O6S2 |
| Molecular Weight | 454.60000 |
| Flash Point | 307.3ºC |
| Exact Mass | 454.14800 |
| PSA | 103.50000 |
| LogP | 6.62820 |
| Index of Refraction | 1.541 |
| InChIKey | XOPWJCCQJIIDMU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)C(C)(C)COS(=O)(=O)c2ccc(C)cc2)cc1 |
|
~%
2,2,3,3-tetrame... CAS#:70178-81-3 |
| Literature: Juaristi, Eusebio; Cruz-Sanchez, J. Samuel Journal of Organic Chemistry, 1988 , vol. 53, # 14 p. 3334 - 3338 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2,3,3-tetramethylbutane-1,4-diyl bis(4-methylbenzenesulfonate) |
| 2,2,3,3-tetramethyl-1,4-butanediol ditosylate |
| 2,2,3,3-Tetramethylleutandiyl-1,4-ditosylat |
| 2,2,3,3-tetramethyl-1,4-bis-(toluene-4-sulfonyloxy)-butane |
| 2,2,3,3-Tetramethyl-1,4-bis-(toluol-4-sulfonyloxy)-butan |