4-(PHENYLSULFONYL)ANILINE structure
|
Common Name | 4-(PHENYLSULFONYL)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 7019-01-4 | Molecular Weight | 233.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO2S | Melting Point | 175-177ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(benzenesulfonyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 175-177ºC |
|---|---|
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.28600 |
| Exact Mass | 233.05100 |
| PSA | 68.54000 |
| LogP | 3.76360 |
| InChIKey | GDYFDXDATVPPDR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| HS Code | 2921420090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: In vitro inhibition of Mycobacterium lufu dihydopterate synthase.
Source: ChEMBL
Target: N/A
External Id: CHEMBL664455
|
|
Name: Inhibition of human recombinant full length DDX3X helicase activity expressed in Esch...
Source: ChEMBL
Target: ATP-dependent RNA helicase DDX3X
External Id: CHEMBL5230913
|
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from candida albicans
Source: ChEMBL
Target: N/A
External Id: CHEMBL664460
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from Escherichia coli
Source: ChEMBL
Target: N/A
External Id: CHEMBL664461
|
|
Name: Antimycobacterial activity against DDS resistant Mycobacterium smegmatis ATCC 607 inf...
Source: ChEMBL
Target: Mycolicibacterium smegmatis
External Id: CHEMBL4613772
|
|
Name: Antimycobacterial activity against DDS sensitive Mycobacterium smegmatis ATCC 607 inf...
Source: ChEMBL
Target: Mycolicibacterium smegmatis
External Id: CHEMBL4613771
|
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from Mycobacterium luf...
Source: ChEMBL
Target: N/A
External Id: CHEMBL664463
|
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from Mycobacterium luf...
Source: ChEMBL
Target: N/A
External Id: CHEMBL660536
|
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from Plasmodium berghe...
Source: ChEMBL
Target: Hydroxymethyldihydropterin pyrophosphokinase-dihydropteroate synthase, putative
External Id: CHEMBL660537
|
| 4-aminophenyl phenyl sulfone |
| 4-benzenesulphonyl-phenylamine |
| p-aminophenyl phenyl sulfone |
| p-Phenylsulfonylaniline |
| 4-Aminodiphenylsulfone |
| 4-Benzenesulfonyl-phenylamine |
| 1-amino-4-phenylsulfonylbenzene |